Lisagail Lisagail

02-12-2020
Mathematics

contestada

which expession is equivalent to negative 2 1/4 over nagative 2/3

Respuesta :

taydden03 taydden03

02-12-2020

Answer:

Ahhhhhjhhhjhhhh

Step-by-step explanation:

How that helps ;)

Answer Link

Otras preguntas

The CD Recyclery sells used CDs for $10 each and buys them for $6 each. Bob paid $20 when he bought and sold the same number of CDs. How many CDs did he buy?

Which relation is a function?

Vhat is the solution to the following system? 3x+10y- 12z = 40 X-5y = 0 X-4z = 0

n the poem "raven" Which technique contributes most to the suspense created in this poem? the speaker's indignant response to having been woken up the name of t

julia's hair is 4cm long. Her hair grows 1.5cm per month. Julia wants her hair to grow at least 7cm long. Write an inequality to determine the number of month

Who partnered with President Roosevelt in pushing the new deal programs?

I have a deck of 54 cards, and I deal all of the cards to x players, with each player getting y cards. If x is at least 2 and y is at least 5, then how many pos

An industrial vat contains 650 grams of solid lead(II) chloride formed from a reaction of 870 grams of lead(II) nitrate with excess hydrochloric acid. This is t

cosec(6b+pi/8)=sec(2b-pi/8)

A line with a slope of -3 passes through the points (-5,1) and (-3,u). What is the value of u? u= Help!